CAS 727419-55-8
:(3-bromophenyl)(2,3-dihydro-1,4-benzodioxin-6-yl)methanone
Description:
The chemical substance known as (3-bromophenyl)(2,3-dihydro-1,4-benzodioxin-6-yl)methanone, with the CAS number 727419-55-8, is an organic compound characterized by its complex structure, which includes a bromophenyl group and a benzodioxin moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and stability. The presence of the bromine atom introduces significant electronegativity, which can influence the compound's reactivity, particularly in electrophilic substitution reactions. The benzodioxin structure may impart unique chemical properties, such as the ability to participate in various chemical transformations, including oxidation and reduction reactions. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its solubility, melting point, and other physical properties would depend on the specific conditions and solvents used. Overall, this compound represents a fascinating example of synthetic organic chemistry with potential applications in various fields.
Formula:C15H11BrO3
InChI:InChI=1/C15H11BrO3/c16-12-3-1-2-10(8-12)15(17)11-4-5-13-14(9-11)19-7-6-18-13/h1-5,8-9H,6-7H2
SMILES:c1cc(cc(c1)Br)C(=O)c1ccc2c(c1)OCCO2
Synonyms:- Methanone, (3-Bromophenyl)(2,3-Dihydro-1,4-Benzodioxin-6-Yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.