CymitQuimica logo

CAS 727421-75-2

:

2,3-dihydro-1,4-benzodioxin-6-yl(2-iodophenyl)methanone

Description:
2,3-Dihydro-1,4-benzodioxin-6-yl(2-iodophenyl)methanone is a chemical compound characterized by its unique structure, which includes a benzodioxin moiety and an iodophenyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the carbonyl group. The benzodioxin structure contributes to its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as it may interact with biological targets through various mechanisms. The iodine atom in the 2-iodophenyl group can enhance the compound's lipophilicity and may also play a role in its biological activity, potentially influencing binding interactions with proteins or enzymes. Additionally, the compound may exhibit fluorescence properties, making it useful in imaging applications. As with many organic compounds, its solubility, melting point, and other physical properties would depend on the specific conditions and solvents used. Safety and handling precautions should be observed due to the presence of iodine and the potential for biological activity.
Formula:C15H11IO3
InChI:InChI=1/C15H11IO3/c16-12-4-2-1-3-11(12)15(17)10-5-6-13-14(9-10)19-8-7-18-13/h1-6,9H,7-8H2
SMILES:c1ccc(c(c1)C(=O)c1ccc2c(c1)OCCO2)I
Synonyms:
  • Methanone, (2,3-Dihydro-1,4-Benzodioxin-6-Yl)(2-Iodophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.