
CAS 72744-46-8
:5-Bromo-4-chloro-1,3-benzodioxole
Description:
5-Bromo-4-chloro-1,3-benzodioxole is an organic compound characterized by its unique structure, which includes a benzodioxole moiety substituted with bromine and chlorine atoms. This compound typically appears as a solid and is known for its aromatic properties due to the presence of the benzene ring. The bromine and chlorine substituents can influence its reactivity, making it a potential candidate for various chemical reactions, including electrophilic aromatic substitution. The presence of the dioxole ring contributes to its stability and can affect its solubility in different solvents. This compound may be utilized in synthetic organic chemistry, particularly in the development of pharmaceuticals or agrochemicals, due to its potential biological activity. Safety data indicates that, like many halogenated compounds, it should be handled with care, as it may pose environmental and health risks. Overall, 5-Bromo-4-chloro-1,3-benzodioxole is a versatile compound with applications in research and industry, warranting further investigation into its properties and uses.
Formula:C7H4BrClO2
InChI:InChI=1S/C7H4BrClO2/c8-4-1-2-5-7(6(4)9)11-3-10-5/h1-2H,3H2
InChI key:InChIKey=SBNRIUMWIAAIBL-UHFFFAOYSA-N
SMILES:ClC1=C2C(=CC=C1Br)OCO2
Synonyms:- 5-Bromo-4-chloro-1,3-benzodioxole
- 1,3-Benzodioxole, 5-bromo-4-chloro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.