CymitQuimica logo

CAS 72744-56-0

:

5-bromo-1,3-benzodioxole-4-carboxylic acid

Description:
5-Bromo-1,3-benzodioxole-4-carboxylic acid is an organic compound characterized by its unique structure, which includes a bromine atom and a dioxole ring fused to a benzene system. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of the bromine substituent can influence its reactivity and solubility, often enhancing its biological activity. The dioxole moiety is known for its stability and can participate in various chemical reactions, making this compound of interest in synthetic organic chemistry and medicinal chemistry. Its molecular structure allows for potential interactions with biological targets, which may lead to applications in pharmaceuticals or agrochemicals. Additionally, the compound's solubility and stability in different solvents can vary, affecting its handling and application in laboratory settings. Overall, 5-bromo-1,3-benzodioxole-4-carboxylic acid is a versatile compound with significant implications in research and development within the chemical and pharmaceutical industries.
Formula:C8H5BrO4
InChI:InChI=1/C8H5BrO4/c9-4-1-2-5-7(13-3-12-5)6(4)8(10)11/h1-2H,3H2,(H,10,11)
InChI key:HDNXEXSQANVCKC-UHFFFAOYSA-N
SMILES:c1cc2c(c(c1Br)C(=O)O)OCO2
Found 5 products.