CAS 72745-76-7
:2-methyl-1,3-benzoxazol-5-amine
Description:
2-Methyl-1,3-benzoxazol-5-amine is an organic compound characterized by its benzoxazole structure, which consists of a fused benzene and oxazole ring. This compound features a methyl group at the second position and an amino group at the fifth position of the benzoxazole ring. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group, which can engage in hydrogen bonding. The compound is of interest in various fields, including medicinal chemistry, due to its potential biological activities. It may serve as a building block for the synthesis of more complex molecules or as a ligand in coordination chemistry. Additionally, its structural features suggest potential applications in pharmaceuticals, agrochemicals, or materials science. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken during use.
Formula:C8H8N2O
InChI:InChI=1/C8H8N2O/c1-5-10-7-4-6(9)2-3-8(7)11-5/h2-4H,9H2,1H3
SMILES:Cc1nc2cc(ccc2o1)N
Synonyms:- 2-Methyl-5-aminobenzoxazole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-methyl-1,3-benzoxazol-5-amine
CAS:Formula:C8H8N2OPurity:96%Color and Shape:SolidMolecular weight:148.16195-Amino-2-methyl-1,3-benzoxazole
CAS:5-Amino-2-methyl-1,3-benzoxazoleFormula:C8H8N2OPurity:≥95%Color and Shape: powderMolecular weight:148.16g/mol2-Methyl-1,3-benzoxazol-5-amine
CAS:Formula:C8H8N2OPurity:95%Color and Shape:SolidMolecular weight:148.1652-Methylbenzo[d]oxazol-5-amine
CAS:2-Methylbenzo[d]oxazol-5-amine is a drug that has been shown to have an anti-tuberculosis effect in mice. It has a low oral bioavailability, which may be due to its absorption through the gut mucosa and not the small intestine. 2-Methylbenzo[d]oxazol-5-amine inhibits mycobacterial growth by binding to DNA gyrase, preventing transcription and replication. This drug also has a strong inhibitory effect on macrophages, which are cells that play an important role in immunity against bacteria.Formula:C8H8N2OPurity:Min. 95%Molecular weight:148.16 g/mol



