CAS 72748-87-9
:4-[[(3-Carboxy-1-oxo-2-propen-1-yl)amino]methyl]cyclohexanecarboxylic acid
Description:
4-[[(3-Carboxy-1-oxo-2-propen-1-yl)amino]methyl]cyclohexanecarboxylic acid, with the CAS number 72748-87-9, is a chemical compound that features a cyclohexane ring substituted with carboxylic acid groups and an amino group. This compound is characterized by its complex structure, which includes both aliphatic and aromatic characteristics due to the presence of the cyclohexane and the propenyl moiety. It is likely to exhibit properties typical of amino acids and carboxylic acids, such as solubility in polar solvents and potential for forming hydrogen bonds. The presence of multiple functional groups suggests that it may participate in various chemical reactions, including esterification and amidation. Additionally, its structure may confer biological activity, making it of interest in pharmaceutical and biochemical research. The compound's stability, reactivity, and potential applications would depend on its specific molecular interactions and the conditions under which it is used.
Formula:C12H17NO5
InChI:InChI=1S/C12H17NO5/c14-10(5-6-11(15)16)13-7-8-1-3-9(4-2-8)12(17)18/h5-6,8-9H,1-4,7H2,(H,13,14)(H,15,16)(H,17,18)
InChI key:InChIKey=XFEDBGCHJRFAAA-UHFFFAOYSA-N
SMILES:C(NC(C=CC(O)=O)=O)C1CCC(C(O)=O)CC1
Synonyms:- Cyclohexanecarboxylic acid, 4-[[(3-carboxy-1-oxo-2-propenyl)amino]methyl]-
- 4-[[(3-Carboxy-1-oxo-2-propen-1-yl)amino]methyl]cyclohexanecarboxylic acid
- Cyclohexanecarboxylic acid, 4-[[(3-carboxy-1-oxo-2-propen-1-yl)amino]methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N-[4-(-Carboxycyclohexylmethyl)]maleamidic Acid
CAS:Controlled ProductApplications N-[4-(-Carboxycyclohexylmethyl)]maleamidic Acid (cas# 72748-87-9) is a compound useful in organic synthesis.
Formula:C12H17NO5Color and Shape:NeatMolecular weight:255.27
