CymitQuimica logo

CAS 72748-97-1

:

threonylglycylglycine

Description:
Threonylglycylglycine, with the CAS number 72748-97-1, is a synthetic dipeptide composed of three amino acids: threonine, glycine, and glycine. This compound is characterized by its peptide bonds, which link the amino acids together, resulting in a specific sequence that influences its biochemical properties. Threonylglycylglycine is typically soluble in water due to the presence of polar amino acid side chains, particularly the hydroxyl group in threonine. It may exhibit biological activity, potentially acting as a signaling molecule or influencing metabolic pathways, although specific biological functions can vary. The compound's stability can be affected by environmental factors such as pH and temperature, which may lead to hydrolysis or degradation over time. In research and pharmaceutical contexts, threonylglycylglycine may be studied for its potential applications in drug development, nutrition, or as a model for understanding peptide interactions. Overall, its unique structure and properties make it a subject of interest in biochemistry and molecular biology.
Formula:C8H15N3O5
InChI:InChI=1/C8H15N3O5/c1-4(12)7(9)8(16)11-2-5(13)10-3-6(14)15/h4,7,12H,2-3,9H2,1H3,(H,10,13)(H,11,16)(H,14,15)
SMILES:CC(C(C(=NCC(=NCC(=O)O)O)O)N)O
Synonyms:
  • Thr-Gly-Gly
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.