CymitQuimica logo

CAS 72748-99-3

:

(2R)-2-(methoxymethyl)pyrrolidin-1-amine

Description:
(2R)-2-(methoxymethyl)pyrrolidin-1-amine, with the CAS number 72748-99-3, is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. The "2R" designation indicates that the compound has a specific stereochemistry at the second carbon atom, which is crucial for its biological activity and interactions. The methoxymethyl group attached to the second carbon contributes to its solubility and reactivity, making it a potential candidate for various applications in medicinal chemistry. This compound may exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can influence its pharmacological profile. Additionally, its structural features suggest potential uses in the synthesis of more complex molecules or as a building block in drug development. As with many amines, it may also participate in various chemical reactions, including alkylation and acylation, further expanding its utility in organic synthesis.
Formula:C6H14N2O
InChI:InChI=1/C6H14N2O/c1-9-5-6-3-2-4-8(6)7/h6H,2-5,7H2,1H3/t6-/m1/s1
InChI key:BWSIKGOGLDNQBZ-ZCFIWIBFSA-N
SMILES:COC[C@H]1CCCN1N
Synonyms:
  • (R)-(+)-1-Amino-2-(methoxymethyl)pyrrolidine
  • 1-pyrrolidinamine, 2-(methoxymethyl)-, (2R)-
  • (2R)-1-ammonio-2-(methoxymethyl)pyrrolidinium
  • Ramp
Found 7 products.