CAS 7275-70-9

5,6-Dimethyl-3-(methylthio)-1,2,4-triazine

Description:

5,6-Dimethyl-3-(methylthio)-1,2,4-triazine, with the CAS number 7275-70-9, is a heterocyclic organic compound belonging to the triazine family. This compound features a triazine ring, which is a six-membered aromatic ring containing three nitrogen atoms and three carbon atoms. The presence of two methyl groups at the 5 and 6 positions, along with a methylthio group at the 3 position, contributes to its unique chemical properties and reactivity. It is typically characterized by its moderate solubility in organic solvents and relatively low solubility in water, which is common for many triazine derivatives. The compound may exhibit biological activity, making it of interest in agricultural chemistry and pharmaceuticals. Its structure allows for potential interactions with various biological targets, and it may serve as a precursor or intermediate in the synthesis of more complex molecules. Safety and handling precautions should be observed, as with many chemical substances, due to potential toxicity or environmental impact.

Formula: C₆H₉N₃S

InChI: InChI=1S/C6H9N3S/c1-4-5(2)8-9-6(7-4)10-3/h1-3H3

InChI key: InChIKey=YMBMXBOUDJKXSC-UHFFFAOYSA-N

SMILES: S(C)C=1N=C(C)C(C)=NN1

Synonyms:

• 5,6-Dimethyl-3-(methylthio)-1,2,4-triazine
• 1,2,4-Triazine, 5,6-dimethyl-3-(methylthio)-
• 3-Methylthio-5,6-dimethyl-1,2,4-triazine
• as-Triazine, 5,6-dimethyl-3-(methylthio)-