CAS 72752-52-4
:2-(1-Piperidinyl)benzonitrile
Description:
2-(1-Piperidinyl)benzonitrile, with the CAS number 72752-52-4, is an organic compound characterized by its structure, which features a piperidine ring attached to a benzonitrile moiety. This compound typically appears as a white to off-white solid and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the piperidine group contributes to its basicity and can influence its interaction with biological targets, making it of interest in drug design. The nitrile functional group (-C≡N) is notable for its ability to participate in various chemical reactions, including nucleophilic additions and cycloadditions. Additionally, 2-(1-Piperidinyl)benzonitrile may exhibit specific solubility characteristics, often being soluble in organic solvents while having limited solubility in water. Its properties, such as melting point, boiling point, and reactivity, can vary based on the purity and specific conditions under which it is handled. Overall, this compound serves as a valuable scaffold in the synthesis of more complex molecules in the field of organic and medicinal chemistry.
Formula:C12H14N2
InChI:InChI=1S/C12H14N2/c13-10-11-6-2-3-7-12(11)14-8-4-1-5-9-14/h2-3,6-7H,1,4-5,8-9H2
InChI key:InChIKey=MEBVSLLKZSAIGK-UHFFFAOYSA-N
SMILES:C(#N)C1=C(C=CC=C1)N2CCCCC2
Synonyms:- 2-(1-Piperidino)benzonitrile
- 2-(1-Piperidinyl)benzonitrile
- 2-(Piperidin-1-yl)benzonitrile
- 2-Piperidin-1-Ylbenzonitrile
- Benzonitrile, 2-(1-piperidinyl)-
- 2-Piperidinobenzonitrile
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-(1-Piperidinyl)benzonitrile, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C12H14N2Purity:97%Color and Shape:White, Crystals or powder or crystalline powder or chunksMolecular weight:186.262-(Piperidin-1-yl)benzonitrile
CAS:Formula:C12H14N2Purity:97%Color and Shape:SolidMolecular weight:186.25302-(Piperidin-1-yl)benzonitrile
CAS:2-(Piperidin-1-yl)benzonitrilePurity:98%Color and Shape:Pale Yellow SolidMolecular weight:186.25g/mol2-Piperidinobenzonitrile
CAS:Formula:C12H14N2Purity:97.0%Color and Shape:SolidMolecular weight:186.258




