CAS 72760-85-1
:3-Amino-5-(methylthio)pyrazole-4-carbonitrile
Description:
3-Amino-5-(methylthio)pyrazole-4-carbonitrile is an organic compound characterized by its pyrazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features an amino group (-NH2) and a methylthio group (-S-CH3) attached to the pyrazole ring, as well as a cyano group (-C≡N) at the 4-position. The presence of these functional groups contributes to its potential reactivity and biological activity. The compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents. Its unique structure makes it of interest in various fields, including medicinal chemistry and agrochemicals, where it may serve as a building block for the synthesis of more complex molecules. Additionally, the compound's properties, such as melting point, boiling point, and spectral characteristics, can vary based on purity and environmental conditions. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C5H6N4S
InChI:InChI=1/C5H6N4S/c1-10-5-3(2-6)4(7)8-9-5/h1H3,(H3,7,8,9)
SMILES:CSc1c(C#N)c(N)[nH]n1
Synonyms:- 5-amino-3-(methylsulfanyl)-1H-pyrazole-4-carbonitrile
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Amino-5-methylthio-1H-pyrazole-4-carbonitrile, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C5H6N4SPurity:97%Molecular weight:154.193-Amino-5-(methylthio)-1H-pyrazole-4-carbonitrile
CAS:Formula:C5H6N4SPurity:95%Color and Shape:SolidMolecular weight:154.19293-Amino-5-(Methylthio)-1H-Pyrazole-4-Carbonitrile
CAS:3-Amino-5-(Methylthio)-1H-Pyrazole-4-CarbonitrilePurity:99%Molecular weight:154.19g/mol3-Amino-4-cyano-5-methylthiopyrazole
CAS:Formula:C5H6N4SPurity:98%Color and Shape:SolidMolecular weight:154.19



