CAS 72761-91-2

Glycine, N-[(3-methylphenyl)methyl]-, hydrochloride

Description:

Glycine, N-[(3-methylphenyl)methyl]-, hydrochloride, with the CAS number 72761-91-2, is a chemical compound that belongs to the class of amino acids and their derivatives. It is a hydrochloride salt of a glycine derivative, which means it contains the amino acid glycine modified by the addition of a 3-methylphenylmethyl group. This modification can influence its solubility, stability, and biological activity. The compound typically appears as a white to off-white crystalline powder and is soluble in water due to the presence of the hydrochloride group. Its molecular structure includes both an amino group and a carboxylic acid group, characteristic of amino acids, which allows it to participate in various biochemical reactions. Glycine derivatives are often studied for their potential applications in pharmaceuticals, particularly in the development of drugs that target the central nervous system or exhibit neuroprotective properties. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information.

Formula: C₁₀H₁₃NO₂·ClH

InChI: InChI=1S/C10H13NO2.ClH/c1-8-3-2-4-9(5-8)6-11-7-10(12)13;/h2-5,11H,6-7H2,1H3,(H,12,13);1H

InChI key: InChIKey=YDTLCKKZVMMENR-UHFFFAOYSA-N

SMILES: C(NCC(O)=O)C1=CC(C)=CC=C1.Cl

Synonyms:

• Glycine, N-[(3-methylphenyl)methyl]-, hydrochloride
• 2-[[(3-Methylphenyl)methyl]amino]acetic acid hydrochloride

2-{[(3-Methylphenyl)methyl]amino}acetic acid hydrochloride

CAS: 72761-91-2

Versatile small molecule scaffold

Formula: C₁₀H₁₄ClNO₂

Purity: Min. 95%

Molecular weight: 215.67 g/mol

Ref: 3D-XCA76191