CAS 727652-04-2
:2-(3-Methoxyphenyl)-7-methylimidazo[1,2-a]pyridine-3-carboxaldehyde
Description:
2-(3-Methoxyphenyl)-7-methylimidazo[1,2-a]pyridine-3-carboxaldehyde is a chemical compound characterized by its complex structure, which includes an imidazo[1,2-a]pyridine core, a methoxyphenyl group, and an aldehyde functional group. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to its structural features. The presence of the methoxy group may influence its solubility and reactivity, while the aldehyde group can participate in various chemical reactions, such as condensation and oxidation. The compound may also exhibit fluorescence or other optical properties, making it of interest in fields such as medicinal chemistry and materials science. Its specific applications and interactions would depend on further studies, including its synthesis, stability, and potential pharmacological effects. As with many organic compounds, safety data and handling precautions should be considered, particularly regarding its reactivity and potential toxicity.
Formula:C16H14N2O2
InChI:InChI=1S/C16H14N2O2/c1-11-6-7-18-14(10-19)16(17-15(18)8-11)12-4-3-5-13(9-12)20-2/h3-10H,1-2H3
InChI key:InChIKey=MZBCCRDBXSINSQ-UHFFFAOYSA-N
SMILES:C(=O)C1=C(N=C2N1C=CC(C)=C2)C3=CC(OC)=CC=C3
Synonyms:- 2-(3-Methoxyphenyl)-7-methylimidazo[1,2-a]pyridine-3-carboxaldehyde
- Imidazo[1,2-a]pyridine-3-carboxaldehyde, 2-(3-methoxyphenyl)-7-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.