CAS 727652-08-6

2-(4-Bromophenyl)-7-methylimidazo[1,2-a]pyridine-3-carboxaldehyde

Description:

2-(4-Bromophenyl)-7-methylimidazo[1,2-a]pyridine-3-carboxaldehyde is a chemical compound characterized by its complex structure, which includes an imidazo[1,2-a]pyridine core, a bromophenyl substituent, and an aldehyde functional group. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to its structural features. The presence of the bromine atom may influence its reactivity and solubility, while the aldehyde group can participate in various chemical reactions, such as condensation and oxidation. The compound is likely to be a solid at room temperature, with specific melting and boiling points that depend on its purity and crystalline form. Its applications may extend to medicinal chemistry, particularly in the development of pharmaceuticals, given the biological relevance of imidazo[1,2-a]pyridine derivatives. Safety data sheets would provide information on handling, storage, and potential hazards associated with this compound, emphasizing the importance of proper laboratory practices when working with such substances.

Formula: C₁₅H₁₁BrN₂O

InChI: InChI=1S/C15H11BrN2O/c1-10-6-7-18-13(9-19)15(17-14(18)8-10)11-2-4-12(16)5-3-11/h2-9H,1H3

InChI key: InChIKey=QOVSUUCAWNLPSJ-UHFFFAOYSA-N

SMILES: C(=O)C1=C(N=C2N1C=CC(C)=C2)C3=CC=C(Br)C=C3

Synonyms:

• Imidazo[1,2-a]pyridine-3-carboxaldehyde, 2-(4-bromophenyl)-7-methyl-
• 2-(4-Bromophenyl)-7-methylimidazo[1,2-a]pyridine-3-carboxaldehyde