CAS 727652-21-3

3-[2-(3-Methoxyphenyl)imidazo[1,2-a]pyridin-3-yl]-2-propenoic acid

Description:

3-[2-(3-Methoxyphenyl)imidazo[1,2-a]pyridin-3-yl]-2-propenoic acid, with the CAS number 727652-21-3, is a chemical compound characterized by its complex structure, which includes an imidazo[1,2-a]pyridine moiety and a propenoic acid functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential biological activity. The presence of the methoxyphenyl group may enhance its lipophilicity and influence its interaction with biological targets. As a propenoic acid derivative, it may participate in various chemical reactions, including esterification and polymerization. The compound's unique structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its solubility, stability, and reactivity would depend on the specific conditions, such as pH and solvent, making it important for researchers to consider these factors in experimental designs. Overall, this compound represents a fascinating area of study within organic and medicinal chemistry.

Formula: C₁₇H₁₄N₂O₃

InChI: InChI=1S/C17H14N2O3/c1-22-13-6-4-5-12(11-13)17-14(8-9-16(20)21)19-10-3-2-7-15(19)18-17/h2-11H,1H3,(H,20,21)

InChI key: InChIKey=QBDQZLDUTLCWSZ-UHFFFAOYSA-N

SMILES: C(=CC(O)=O)C1=C(N=C2N1C=CC=C2)C3=CC(OC)=CC=C3

Synonyms:

• 2-Propenoic acid, 3-[2-(3-methoxyphenyl)imidazo[1,2-a]pyridin-3-yl]-
• 3-[2-(3-Methoxyphenyl)imidazo[1,2-a]pyridin-3-yl]-2-propenoic acid