CAS 727652-30-4

3-[2-(4-Chlorophenyl)-7-methylimidazo[1,2-a]pyridin-3-yl]-2-propenoic acid

Description:

3-[2-(4-Chlorophenyl)-7-methylimidazo[1,2-a]pyridin-3-yl]-2-propenoic acid, with the CAS number 727652-30-4, is a chemical compound characterized by its complex structure, which includes an imidazo[1,2-a]pyridine moiety and a propenoic acid functional group. This compound features a 4-chlorophenyl substituent, contributing to its potential biological activity. The presence of the imidazo[1,2-a]pyridine ring suggests that it may exhibit properties relevant to medicinal chemistry, particularly in the context of drug development. The propenoic acid part of the molecule indicates that it may participate in various chemical reactions, including polymerization or conjugation with other biomolecules. Its unique structural features may influence its solubility, stability, and reactivity, making it of interest in both synthetic and pharmaceutical chemistry. Additionally, the chlorophenyl group may enhance lipophilicity, potentially affecting the compound's pharmacokinetics and interaction with biological targets. Overall, this compound represents a class of heterocyclic compounds that could have significant implications in therapeutic applications.

Formula: C₁₇H₁₃ClN₂O₂

InChI: InChI=1S/C17H13ClN2O2/c1-11-8-9-20-14(6-7-16(21)22)17(19-15(20)10-11)12-2-4-13(18)5-3-12/h2-10H,1H3,(H,21,22)

InChI key: InChIKey=JGYPFQPHSNKOMO-UHFFFAOYSA-N

SMILES: C(=CC(O)=O)C1=C(N=C2N1C=CC(C)=C2)C3=CC=C(Cl)C=C3

Synonyms:

• 2-Propenoic acid, 3-[2-(4-chlorophenyl)-7-methylimidazo[1,2-a]pyridin-3-yl]-
• 3-[2-(4-Chlorophenyl)-7-methylimidazo[1,2-a]pyridin-3-yl]-2-propenoic acid