CAS 72766-92-8
:Actinomycin D1
Description:
Actinomycin D1, with the CAS number 72766-92-8, is a potent antibiotic and anticancer agent derived from the bacterium *Streptomyces parvulus*. It is characterized by its complex polypeptide structure, which includes a phenoxazone chromophore and a series of amino acids. Actinomycin D1 functions primarily by intercalating into DNA, thereby inhibiting RNA synthesis and disrupting cellular processes, which makes it effective against rapidly dividing cancer cells. This compound exhibits a broad spectrum of biological activity, including antitumor effects, and has been utilized in the treatment of various cancers, such as Wilms' tumor and rhabdomyosarcoma. However, its use is limited by potential side effects, including myelosuppression and toxicity to normal tissues. Actinomycin D1 is typically administered intravenously and requires careful monitoring due to its potent effects and associated risks. Its mechanism of action and structural properties make it a significant compound in both clinical and research settings, particularly in the study of cancer therapeutics and molecular biology.
Formula:C69H98N14O19
InChI:InChI=1/C69H98N14O19/c1-29(2)46(70)67(96)99-28-42(84)72-39-25-38(59(88)76-50-36(13)100-68(97)54(32(7)8)80(17)43(85)26-78(15)63(92)40-21-19-23-82(40)65(94)48(30(3)4)74-61(50)90)52-57(34(39)11)102-58-35(12)56(87)47(71)45(53(58)73-52)60(89)77-51-37(14)101-69(98)55(33(9)10)81(18)44(86)27-79(16)64(93)41-22-20-24-83(41)66(95)49(31(5)6)75-62(51)91/h25,29-33,36-37,40-41,46,48-51,54-55H,19-24,26-28,70-71H2,1-18H3,(H,72,84)(H,74,90)(H,75,91)(H,76,88)(H,77,89)
Synonyms:- 2-[(2-amino-4,6-dimethyl-3-oxo-1,9-bis{[2,5,9-trimethyl-1,4,7,11,14-pentaoxo-6,13-di(propan-2-yl)hexadecahydro-1H-pyrrolo[2,1-i][1,4,7,10,13]oxatetraazacyclohexadecin-10-yl]carbamoyl}-3H-phenoxazin-7-yl)amino]-2-oxoethyl valinate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Actinomycin D1
CAS:Actinomycin D1 is a DNA inhibitor.Formula:C69H98N14O19Color and Shape:SolidMolecular weight:1427.6
