CymitQuimica logo

CAS 727664-36-0

:

Tetrahydro-5-[2-(4-morpholinyl)ethyl]-1,3,5-triazine-2(1H)-thione

Description:
Tetrahydro-5-[2-(4-morpholinyl)ethyl]-1,3,5-triazine-2(1H)-thione is a chemical compound characterized by its unique triazine core structure, which is a six-membered ring containing three nitrogen atoms and three carbon atoms. The presence of a thione functional group (a sulfur atom double-bonded to a carbon atom) contributes to its reactivity and potential biological activity. The morpholine moiety, a cyclic amine, enhances the compound's solubility and may influence its pharmacological properties. This compound is typically synthesized through multi-step organic reactions, and its applications may include use in pharmaceuticals, agrochemicals, or as a research chemical. Its specific properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the presence of functional groups. Safety data and handling precautions are essential, as with any chemical, to ensure safe usage in laboratory or industrial settings.
Formula:C9H18N4OS
InChI:InChI=1S/C9H18N4OS/c15-9-10-7-13(8-11-9)2-1-12-3-5-14-6-4-12/h1-8H2,(H2,10,11,15)
InChI key:InChIKey=SIMHLWZZLXUZDX-UHFFFAOYSA-N
SMILES:C(CN1CCOCC1)N2CNC(=S)NC2
Synonyms:
  • 1,3,5-Triazine-2(1H)-thione, tetrahydro-5-[2-(4-morpholinyl)ethyl]-
  • Tetrahydro-5-[2-(4-morpholinyl)ethyl]-1,3,5-triazine-2(1H)-thione
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.