CymitQuimica logo

CAS 727664-65-5

:

8-Ethyl-5,6-dihydro-4,4,6-trimethyl-4H-pyrrolo[3,2,1-ij]quinoline-1,2-dione

Description:
8-Ethyl-5,6-dihydro-4,4,6-trimethyl-4H-pyrrolo[3,2,1-ij]quinoline-1,2-dione, with the CAS number 727664-65-5, is a synthetic organic compound characterized by its complex bicyclic structure, which incorporates both pyrrole and quinoline moieties. This compound features multiple methyl groups and an ethyl substituent, contributing to its unique chemical properties and potential biological activity. The presence of the diketone functional groups suggests that it may participate in various chemical reactions, including nucleophilic additions and condensation reactions. Its structural features may also influence its solubility, stability, and reactivity in different solvents. While specific applications may vary, compounds of this type are often investigated for their potential in medicinal chemistry, particularly in the development of pharmaceuticals due to their structural diversity and ability to interact with biological targets. Further studies would be necessary to elucidate its specific properties, including its spectral characteristics, reactivity, and potential applications in various fields.
Formula:C16H19NO2
InChI:InChI=1S/C16H19NO2/c1-5-10-6-11-9(2)8-16(3,4)17-13(11)12(7-10)14(18)15(17)19/h6-7,9H,5,8H2,1-4H3
InChI key:InChIKey=WSDFNKPPSKGMIP-UHFFFAOYSA-N
SMILES:CC1(C)N2C=3C(C(=O)C2=O)=CC(CC)=CC3C(C)C1
Synonyms:
  • 8-Ethyl-5,6-dihydro-4,4,6-trimethyl-4H-pyrrolo[3,2,1-ij]quinoline-1,2-dione
  • 4H-Pyrrolo[3,2,1-ij]quinoline-1,2-dione, 8-ethyl-5,6-dihydro-4,4,6-trimethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.