CAS 727674-58-0
:2-(Phenoxymethyl)-4,4(5H)-oxazoledimethanol
Description:
2-(Phenoxymethyl)-4,4(5H)-oxazoledimethanol, identified by its CAS number 727674-58-0, is a chemical compound that features a unique oxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen atoms. This substance is characterized by the presence of a phenoxymethyl group, which contributes to its potential reactivity and solubility properties. The dimethanol functional groups suggest that it may exhibit hydroxyl (-OH) functionalities, which can enhance its ability to form hydrogen bonds, influencing its solubility in polar solvents. The oxazole moiety may also impart biological activity, making it of interest in medicinal chemistry. Typically, compounds like this can be evaluated for their potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. However, specific physical properties such as melting point, boiling point, and solubility would need to be referenced from experimental data or literature for precise applications and handling guidelines.
Formula:C12H15NO4
InChI:InChI=1S/C12H15NO4/c14-7-12(8-15)9-17-11(13-12)6-16-10-4-2-1-3-5-10/h1-5,14-15H,6-9H2
InChI key:InChIKey=XJCUBIFAIWMENR-UHFFFAOYSA-N
SMILES:C(O)C1(CO)N=C(COC2=CC=CC=C2)OC1
Synonyms:- [4-(Hydroxymethyl)-2-(phenoxymethyl)-5H-1,3-oxazol-4-yl]methanol
- 4,4(5H)-Oxazoledimethanol, 2-(phenoxymethyl)-
- [4-(Hydroxymethyl)-2-(phenoxymethyl)-4,5-dihydro-1,3-oxazol-4-yl]methanol
- 2-(Phenoxymethyl)-4,4(5H)-oxazoledimethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.