CymitQuimica logo

CAS 727674-99-9

:

4,5-Dihydro-4-methyl-2-(phenoxymethyl)-4-oxazolemethanol

Description:
4,5-Dihydro-4-methyl-2-(phenoxymethyl)-4-oxazolemethanol is a chemical compound characterized by its oxazolemethanol structure, which includes a five-membered heterocyclic ring containing nitrogen and oxygen. This compound features a dihydro configuration, indicating the presence of two hydrogen atoms that contribute to its saturation. The methyl group attached to the oxazole ring enhances its hydrophobic characteristics, while the phenoxymethyl group introduces a phenolic moiety, which can influence its reactivity and solubility in organic solvents. The presence of hydroxyl (-OH) functionality suggests potential for hydrogen bonding, which may affect its physical properties, such as boiling point and solubility in water. This compound may exhibit biological activity, making it of interest in medicinal chemistry, although specific biological properties would require further investigation. Overall, its unique structural features contribute to its potential applications in various fields, including pharmaceuticals and materials science.
Formula:C12H15NO3
InChI:InChI=1S/C12H15NO3/c1-12(8-14)9-16-11(13-12)7-15-10-5-3-2-4-6-10/h2-6,14H,7-9H2,1H3
InChI key:InChIKey=ZCMJTBAWOCMVFW-UHFFFAOYSA-N
SMILES:C(O)C1(C)N=C(COC2=CC=CC=C2)OC1
Synonyms:
  • 4-Oxazolemethanol, 4,5-dihydro-4-methyl-2-(phenoxymethyl)-
  • 4,5-Dihydro-4-methyl-2-(phenoxymethyl)-4-oxazolemethanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.