CAS 727675-30-1

3-Methoxy-N-phenyl-2-naphthalenemethanamine

Description:

3-Methoxy-N-phenyl-2-naphthalenemethanamine, identified by its CAS number 727675-30-1, is an organic compound characterized by its complex structure, which includes a naphthalene moiety and a methoxy group. This compound features a phenyl group attached to a nitrogen atom, which is further connected to a naphthalene derivative. The presence of the methoxy group enhances its solubility in organic solvents and may influence its reactivity and interaction with biological systems. Typically, compounds of this nature are investigated for their potential applications in pharmaceuticals, particularly in the development of drugs targeting neurological or psychiatric conditions. The molecular structure suggests potential for various interactions, including hydrogen bonding and π-π stacking, which can affect its biological activity. Additionally, the compound's stability, solubility, and reactivity can be influenced by factors such as pH and temperature, making it a subject of interest in both synthetic and medicinal chemistry. Further studies would be necessary to fully elucidate its properties and potential applications.

Formula: C₁₈H₁₇NO

InChI: InChI=1S/C18H17NO/c1-20-18-12-15-8-6-5-7-14(15)11-16(18)13-19-17-9-3-2-4-10-17/h2-12,19H,13H2,1H3

InChI key: InChIKey=PVKVWXKTSDMITB-UHFFFAOYSA-N

SMILES: C(NC1=CC=CC=C1)C2=CC3=C(C=C2OC)C=CC=C3

Synonyms:

• 3-Methoxy-N-phenyl-2-naphthalenemethanamine
• 2-Naphthalenemethanamine, 3-methoxy-N-phenyl-