CAS 727682-53-3
:3-(3-methoxyquinoxalin-2-yl)propanoic acid
Description:
3-(3-Methoxyquinoxalin-2-yl)propanoic acid is a chemical compound characterized by its quinoxaline structure, which is a bicyclic aromatic compound containing two nitrogen atoms in the ring. This substance features a propanoic acid functional group, contributing to its acidic properties. The methoxy group attached to the quinoxaline ring enhances its solubility and may influence its biological activity. Typically, compounds like this can exhibit various pharmacological properties, including potential roles in medicinal chemistry as they may interact with biological targets. The presence of both the quinoxaline moiety and the carboxylic acid group suggests potential applications in drug development, particularly in areas related to neuropharmacology or anti-inflammatory research. Additionally, the compound's molecular structure may allow for various synthetic modifications, enabling the exploration of structure-activity relationships. As with many organic compounds, its stability, reactivity, and solubility can be influenced by environmental conditions such as pH and temperature.
Formula:C12H12N2O3
InChI:InChI=1/C12H12N2O3/c1-17-12-10(6-7-11(15)16)13-8-4-2-3-5-9(8)14-12/h2-5H,6-7H2,1H3,(H,15,16)
SMILES:COc1c(CCC(=O)O)nc2ccccc2n1
Synonyms:- 2-Quinoxalinepropanoic Acid, 3-Methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.