CAS 727689-55-6

4-[[(3-Chlorophenyl)sulfonyl]amino]benzoic acid

Description:

4-[[(3-Chlorophenyl)sulfonyl]amino]benzoic acid, identified by its CAS number 727689-55-6, is a chemical compound characterized by its sulfonamide functional group, which features a sulfonyl group attached to an amino group. This compound typically exhibits properties associated with both aromatic and acidic functionalities due to the presence of the benzoic acid moiety. The chlorophenyl group contributes to its hydrophobic characteristics, while the sulfonamide group can enhance its solubility in polar solvents. It is often studied for its potential applications in pharmaceuticals, particularly in the development of drugs targeting specific biological pathways. The presence of the chlorine atom may influence its reactivity and biological activity, making it a subject of interest in medicinal chemistry. Additionally, the compound's structural features suggest it may participate in hydrogen bonding, which can affect its interactions with biological macromolecules. Overall, 4-[[(3-Chlorophenyl)sulfonyl]amino]benzoic acid is a compound of interest due to its unique chemical structure and potential applications in various fields.

Formula: C₁₃H₁₀ClNO₄S

InChI: InChI=1S/C13H10ClNO4S/c14-10-2-1-3-12(8-10)20(18,19)15-11-6-4-9(5-7-11)13(16)17/h1-8,15H,(H,16,17)

InChI key: InChIKey=JQVIQJNDKGSTPV-UHFFFAOYSA-N

SMILES: N(S(=O)(=O)C1=CC(Cl)=CC=C1)C2=CC=C(C(O)=O)C=C2

Synonyms:

• Benzoic acid, 4-[[(3-chlorophenyl)sulfonyl]amino]-
• 4-(3-Chlorobenzenesulfonylamino)benzoic acid
• 4-[[(3-Chlorophenyl)sulfonyl]amino]benzoic acid

4-((3-chlorophenyl)sulfonamido)benzoic acid

CAS: 727689-55-6

Formula: C₁₃H₁₀ClNO₄S

Purity: 95.0%

Molecular weight: 311.74

Ref: 10-F512142