CAS 727704-79-2

7,8-Dichloro-2,3-dihydro-1,4-dioxino[2,3-g]quinoxaline

Description:

7,8-Dichloro-2,3-dihydro-1,4-dioxino[2,3-g]quinoxaline is a heterocyclic compound characterized by its unique bicyclic structure that incorporates both dioxin and quinoxaline moieties. This compound features two chlorine atoms at the 7 and 8 positions, contributing to its chemical reactivity and potential biological activity. The presence of the dioxin ring enhances its stability and may influence its solubility and interaction with biological systems. Typically, compounds of this nature are studied for their pharmacological properties, including potential applications in medicinal chemistry. The molecular structure suggests that it may exhibit interesting electronic properties due to the conjugated system, which can affect its reactivity and interactions with other molecules. Additionally, the chlorine substituents can modulate the compound's lipophilicity and biological activity. As with many heterocycles, the synthesis and characterization of this compound are crucial for understanding its potential applications in drug development or as a research tool in various chemical and biological studies.

Formula: C₁₀H₆Cl₂N₂O₂

InChI: InChI=1S/C10H6Cl2N2O2/c11-9-10(12)14-6-4-8-7(3-5(6)13-9)15-1-2-16-8/h3-4H,1-2H2

InChI key: InChIKey=DNKJBNFYZKYVGM-UHFFFAOYSA-N

SMILES: ClC1=NC2=C(C=C3C(=C2)OCCO3)N=C1Cl

Synonyms:

• 7,8-Dichloro-2,3-dihydro-1,4-dioxino[2,3-g]quinoxaline
• 1,4-Dioxino[2,3-g]quinoxaline, 7,8-dichloro-2,3-dihydro-