CAS 727718-11-8

1-[[4-Chloro-3-(trifluoromethyl)phenyl]sulfonyl]-4-piperidinecarboxylic acid

Description:

1-[[4-Chloro-3-(trifluoromethyl)phenyl]sulfonyl]-4-piperidinecarboxylic acid is a chemical compound characterized by its complex structure, which includes a piperidine ring and a sulfonyl group attached to a chlorinated aromatic system. The presence of the trifluoromethyl group enhances its lipophilicity and may influence its biological activity. This compound is typically utilized in pharmaceutical research and development, particularly in the synthesis of potential therapeutic agents. Its sulfonyl moiety can participate in various chemical reactions, making it a versatile intermediate in organic synthesis. The compound's properties, such as solubility, stability, and reactivity, are influenced by the functional groups present, including the electron-withdrawing effects of the chloro and trifluoromethyl groups. Additionally, its carboxylic acid functionality may contribute to its acidity and potential interactions in biological systems. Overall, this compound exemplifies the intricate relationship between molecular structure and chemical behavior, making it of interest in medicinal chemistry and related fields.

Formula: C₁₃H₁₃ClF₃NO₄S

InChI: InChI=1S/C13H13ClF3NO4S/c14-11-2-1-9(7-10(11)13(15,16)17)23(21,22)18-5-3-8(4-6-18)12(19)20/h1-2,7-8H,3-6H2,(H,19,20)

InChI key: InChIKey=LUVBPRSIHUQMSZ-UHFFFAOYSA-N

SMILES: S(=O)(=O)(C1=CC(C(F)(F)F)=C(Cl)C=C1)N2CCC(C(O)=O)CC2

Synonyms:

• 1-[[4-Chloro-3-(trifluoromethyl)phenyl]sulfonyl]-4-piperidinecarboxylic acid
• 4-Piperidinecarboxylic acid, 1-[[4-chloro-3-(trifluoromethyl)phenyl]sulfonyl]-