CAS 727718-12-9

1-[(2,5-Dibromophenyl)sulfonyl]-4-piperidinecarboxylic acid

Description:

1-[(2,5-Dibromophenyl)sulfonyl]-4-piperidinecarboxylic acid is a chemical compound characterized by its unique structure, which includes a piperidine ring and a sulfonyl group attached to a dibromophenyl moiety. This compound typically exhibits properties associated with both acidic and aromatic functionalities, making it potentially useful in various chemical applications, including medicinal chemistry. The presence of the sulfonyl group can enhance solubility and reactivity, while the dibromophenyl group may contribute to its biological activity. The piperidine ring is known for its role in pharmacology, often serving as a scaffold for drug development. Additionally, the compound's molecular structure suggests it may participate in hydrogen bonding and other intermolecular interactions, influencing its behavior in biological systems. Overall, this compound's characteristics make it a subject of interest for further research, particularly in the fields of organic synthesis and drug discovery.

Formula: C₁₂H₁₃Br₂NO₄S

InChI: InChI=1S/C12H13Br2NO4S/c13-9-1-2-10(14)11(7-9)20(18,19)15-5-3-8(4-6-15)12(16)17/h1-2,7-8H,3-6H2,(H,16,17)

InChI key: InChIKey=RQXUXJDNTNDETQ-UHFFFAOYSA-N

SMILES: S(=O)(=O)(C1=C(Br)C=CC(Br)=C1)N2CCC(C(O)=O)CC2

Synonyms:

• 1-[(2,5-Dibromophenyl)sulfonyl]-4-piperidinecarboxylic acid
• 4-Piperidinecarboxylic acid, 1-[(2,5-dibromophenyl)sulfonyl]-

1-(2,5-Dibromobenzenesulfonyl)piperidine-4-carboxylic acid

CAS: 727718-12-9

Versatile small molecule scaffold

Formula: C₁₂H₁₃Br₂NO₄S

Purity: Min. 95%

Molecular weight: 427.11 g/mol

Ref: 3D-CEB71812