CAS 72773-04-7

1H-benzotriazole-1-carboxaldehyde

Description:

1H-benzotriazole-1-carboxaldehyde is an organic compound characterized by its benzotriazole structure, which consists of a triazole ring fused to a benzene ring. This compound features a carboxaldehyde functional group, making it an aldehyde derivative of benzotriazole. It is typically a white to light yellow crystalline solid, soluble in organic solvents like ethanol and acetone, but less soluble in water. The presence of the carboxaldehyde group imparts reactivity, allowing it to participate in various chemical reactions, such as condensation and oxidation. 1H-benzotriazole-1-carboxaldehyde is often utilized in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to act as a building block or intermediate. Additionally, it exhibits potential applications in corrosion inhibition and as a stabilizer for certain materials. Safety data indicates that, like many organic compounds, it should be handled with care, using appropriate safety measures to avoid exposure.

Formula: C₇H₅N₃O

InChI: InChI=1/C7H5N3O/c11-5-10-7-4-2-1-3-6(7)8-9-10/h1-5H

SMILES: c1ccc2c(c1)nnn2C=O

Synonyms:

• 1H-benzotriazole-1-carbaldehyde

1H-Benzo[d][1,2,3]triazole-1-carbaldehyde

CAS: 72773-04-7

Formula: C₇H₅N₃O

Purity: 95%

Color and Shape: Solid

Molecular weight: 147.1341

Ref: IN-DA005P1K

1H-Benzotriazole-1-carboxaldehyde

CAS: 72773-04-7

1H-Benzotriazole-1-carboxaldehyde

Purity: 99%

Molecular weight: 147.13g/mol

Ref: 54-OR933173

1H-Benzotriazole-1-carboxaldehyde

CAS: 72773-04-7

Formula: C₇H₅N₃O

Purity: >95.0%(GC)

Color and Shape: White to Almost white powder to crystal

Molecular weight: 147.14

Ref: 3B-B3920

1H-Benzo[d][1,2,3]triazole-1-carbaldehyde

CAS: 72773-04-7

Formula: C₇H₅N₃O

Purity: 95%

Color and Shape: Solid

Molecular weight: 147.137

Ref: 10-F219297

1H-Benzotriazole-1-carboxaldehyde

Controlled Product

CAS: 72773-04-7

Formula: C₇H₅N₃O

Color and Shape: Neat

Molecular weight: 147.13

Ref: TR-B207550