CymitQuimica logo

CAS 72782-13-9

:

4-{[methyl(nitroso)amino]methyl}benzoic acid

Description:
4-{[Methyl(nitroso)amino]methyl}benzoic acid, with the CAS number 72782-13-9, is a chemical compound that features a benzoic acid moiety substituted with a methyl(nitroso)amino group. This compound typically exhibits characteristics associated with both aromatic and carboxylic acid functionalities. The presence of the nitroso group introduces potential reactivity, particularly in terms of electrophilic interactions. The methyl group attached to the nitrogen can influence the compound's solubility and polarity, affecting its behavior in various solvents. As a benzoic acid derivative, it may exhibit acidic properties, allowing it to participate in acid-base reactions. Additionally, the nitroso group can impart unique spectroscopic properties, making it detectable by techniques such as UV-Vis spectroscopy. The compound's potential applications may include use in organic synthesis, as a reagent, or in the study of biological systems, although specific applications would depend on further research into its reactivity and biological activity. Safety and handling precautions should be observed due to the presence of the nitroso group, which can be associated with toxicity.
Formula:C9H10N2O3
InChI:InChI=1/C9H10N2O3/c1-11(10-14)6-7-2-4-8(5-3-7)9(12)13/h2-5H,6H2,1H3,(H,12,13)
Synonyms:
  • 4-{[Methyl(nitroso)amino]methyl}benzoic acid
  • benzoic acid, 4-[(methylnitrosoamino)methyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.