CymitQuimica logo

CAS 72784-47-5

:

Cyclopropanecarboxylicacid, 1-amino-, ethyl ester

Description:
Cyclopropanecarboxylic acid, 1-amino-, ethyl ester, with the CAS number 72784-47-5, is an organic compound characterized by its cyclopropane ring structure, which contributes to its unique chemical properties. This compound features a carboxylic acid functional group and an amino group, making it an amino acid derivative. The ethyl ester portion indicates that the carboxylic acid is esterified with an ethyl group, enhancing its solubility in organic solvents. Cyclopropanecarboxylic acid derivatives are often of interest in synthetic organic chemistry due to their potential applications in pharmaceuticals and agrochemicals. The presence of the cyclopropane ring can impart strain, influencing reactivity and stability. Additionally, the amino group can participate in various chemical reactions, such as amide formation or nucleophilic substitutions. Overall, this compound's unique structure and functional groups make it a valuable subject of study in both theoretical and applied chemistry contexts.
Formula:C6H11NO2
InChI:InChI=1S/C6H11NO2/c1-2-9-5(8)6(7)3-4-6/h2-4,7H2,1H3
InChI key:FDKHZRAIKUTQLE-UHFFFAOYSA-N
SMILES:CCOC(=O)C1(CC1)N
Synonyms:
  • 1-Amino-1-cyclopropanecarboxylicacid ethyl ester
  • 1-Aminocyclopropanecarboxylic acid ethyl ester
  • Acpce
  • Ethyl1-aminocyclopropanecarboxylate
Found 4 products.