
CAS 72786-12-0
:Sulfamide, N′-[(8α)-1,6-dimethylergolin-8-yl]-N,N-dimethyl-, hydrochloride (1:1)
Description:
Sulfamide, N′-[(8α)-1,6-dimethylergolin-8-yl]-N,N-dimethyl-, hydrochloride (1:1), with CAS number 72786-12-0, is a chemical compound that belongs to the class of sulfonamides, which are characterized by the presence of a sulfonamide functional group (-SO2NH2). This specific compound features a complex structure derived from ergoline, a bicyclic compound known for its presence in various natural products and pharmaceuticals. The presence of dimethyl groups and the specific ergoline backbone contribute to its unique pharmacological properties. As a hydrochloride salt, it is typically more soluble in water, enhancing its bioavailability for potential therapeutic applications. Compounds of this nature are often investigated for their biological activity, including antimicrobial and antidiabetic effects. However, detailed studies on its specific biological activities, toxicity, and pharmacokinetics would be necessary to fully understand its potential uses in medicine. As with all chemical substances, proper handling and safety measures should be observed due to potential health risks associated with exposure.
Formula:C18H26N4O2S·ClH
InChI:InChI=1S/C18H26N4O2S.ClH/c1-20(2)25(23,24)19-13-9-15-14-6-5-7-16-18(14)12(10-21(16)3)8-17(15)22(4)11-13;/h5-7,10,13,15,17,19H,8-9,11H2,1-4H3;1H/t13-,15+,17+;/m0./s1
InChI key:InChIKey=HANSYUJEPWNHIM-IVMONYBCSA-N
SMILES:CN1C2=C3C([C@@]4([C@@](CC3=C1)(N(C)C[C@@H](NS(N(C)C)(=O)=O)C4)[H])[H])=CC=C2.Cl
Synonyms:- 1,6-Dimethyl-8alpha-(N,N-dimethylsulfamoylamino)ergoline monohydrochloride
- Cq-32085
- Cu 32-085
- Cu-32085
- Mesulergine hydrochloride
- N'-[(8alpha)-1,6-Dimethylergolin-8-yl]-N,N-dimethylsulfamide monohydrochloride
- Sulfamide, N′-[(8α)-1,6-dimethylergolin-8-yl]-N,N-dimethyl-, hydrochloride (1:1)
- Sulfamide, N′-[(8α)-1,6-dimethylergolin-8-yl]-N,N-dimethyl-, monohydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Mesulergine hydrochloride
CAS:5-HT2A and 2C receptor antagonistFormula:C18H27ClN4O2SPurity:98%Color and Shape:SolidMolecular weight:398.95Mesulergine hydrochloride
CAS:Mesulergine hydrochloride is a drug that inhibits the dopamine and serotonin receptors. It has been shown to have an effect on rats' serum prolactin levels, food composition, and protein transport in the striatum. Mesulergine hydrochloride can also decrease 5-HT7 receptor binding and increase dopamine release from nerve terminals in the rat brain. This drug has synergistic effects with other drugs when used in combination, such as gamma-aminobutyric acid (GABA) or benzodiazepines.
Symptoms of mesulergine hydrochloride include psychotic disorders, anxiety, depression, hallucinations, sleep problems, and suicidal thoughts. These symptoms may be due to mesulergine's effect on 5-HT2C receptors.Formula:C18H27ClN4O2SPurity:Min. 95%Molecular weight:399 g/molRef: 3D-XCA78612
Discontinued product

