CAS 727971-57-5
:3-Amino-5,5-dimethylhexanoic acid
Description:
3-Amino-5,5-dimethylhexanoic acid, with the CAS number 727971-57-5, is an amino acid derivative characterized by its branched-chain structure. It features an amino group (-NH2) and a carboxylic acid group (-COOH), which are typical functional groups found in amino acids. This compound is notable for its two methyl groups attached to the fifth carbon of the hexanoic acid chain, contributing to its steric bulk and potentially influencing its biochemical properties. The presence of the amino group allows it to participate in various chemical reactions, including peptide bond formation, making it relevant in the synthesis of peptides and proteins. Additionally, its branched structure may affect its solubility and interaction with biological systems. 3-Amino-5,5-dimethylhexanoic acid may also exhibit unique properties in terms of stability and reactivity compared to linear amino acids. Its applications could extend to pharmaceuticals, biochemistry, and materials science, although specific uses may depend on ongoing research and development.
Formula:C8H17NO2
InChI:InChI=1/C8H17NO2/c1-8(2,3)5-6(9)4-7(10)11/h6H,4-5,9H2,1-3H3,(H,10,11)
SMILES:CC(C)(C)CC(CC(=O)O)N
Synonyms:- Hexanoic Acid, 3-Amino-5,5-Dimethyl-
- 3-Amino-5,5-dimethylhexanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.