CAS 727975-83-9
:2-(3,4-Dimethoxyphenyl)-6-methylimidazo[1,2-a]pyridine-3-carboxaldehyde
Description:
2-(3,4-Dimethoxyphenyl)-6-methylimidazo[1,2-a]pyridine-3-carboxaldehyde is a chemical compound characterized by its complex structure, which includes an imidazo[1,2-a]pyridine core fused with a substituted phenyl group. This compound features a carboxaldehyde functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of methoxy groups on the phenyl ring enhances its electron-donating properties, potentially influencing its biological activity and solubility. The methyl group at the 6-position of the imidazo ring may also affect its steric and electronic properties. This compound is of interest in medicinal chemistry and may exhibit various biological activities, making it a candidate for further research in drug development. Its specific properties, such as melting point, solubility, and spectral characteristics, would typically be determined through experimental methods. Overall, the unique structural features of this compound suggest potential utility in various chemical and pharmaceutical applications.
Formula:C17H16N2O3
InChI:InChI=1S/C17H16N2O3/c1-11-4-7-16-18-17(13(10-20)19(16)9-11)12-5-6-14(21-2)15(8-12)22-3/h4-10H,1-3H3
InChI key:InChIKey=IFFIYUJDNXUGFW-UHFFFAOYSA-N
SMILES:C(=O)C1=C(N=C2N1C=C(C)C=C2)C3=CC(OC)=C(OC)C=C3
Synonyms:- Imidazo[1,2-a]pyridine-3-carboxaldehyde, 2-(3,4-dimethoxyphenyl)-6-methyl-
- 2-(3,4-Dimethoxyphenyl)-6-methylimidazo[1,2-a]pyridine-3-carboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.