CAS 727977-52-8

1-[[2-(4-Fluorophenyl)imidazo[1,2-a]pyridin-3-yl]methyl]-4-piperidinecarboxylic acid

Description:

1-[[2-(4-Fluorophenyl)imidazo[1,2-a]pyridin-3-yl]methyl]-4-piperidinecarboxylic acid, with CAS number 727977-52-8, is a chemical compound characterized by its complex structure, which includes an imidazo[1,2-a]pyridine moiety and a piperidine ring. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in organic solvents. The presence of the fluorophenyl group may influence its electronic properties and biological activity, potentially enhancing its interaction with biological targets. The carboxylic acid functional group suggests that it can participate in hydrogen bonding and may exhibit acidic behavior. This compound is of interest in medicinal chemistry, particularly for its potential pharmacological applications, which may include roles as an antagonist or modulator in various biological pathways. Its synthesis and characterization would involve standard organic chemistry techniques, and its stability and reactivity would depend on the specific conditions under which it is handled.

Formula: C₂₀H₂₀FN₃O₂

InChI: InChI=1S/C20H20FN3O2/c21-16-6-4-14(5-7-16)19-17(24-10-2-1-3-18(24)22-19)13-23-11-8-15(9-12-23)20(25)26/h1-7,10,15H,8-9,11-13H2,(H,25,26)

InChI key: InChIKey=GYMOYBLUHVJMPK-UHFFFAOYSA-N

SMILES: C(C1=C(N=C2N1C=CC=C2)C3=CC=C(F)C=C3)N4CCC(C(O)=O)CC4

Synonyms:

• 1-[[2-(4-Fluorophenyl)imidazo[1,2-a]pyridin-3-yl]methyl]-4-piperidinecarboxylic acid
• 4-Piperidinecarboxylic acid, 1-[[2-(4-fluorophenyl)imidazo[1,2-a]pyridin-3-yl]methyl]-

1-[2-(4-Fluoro-phenyl)-imidazo[1,2-a]pyridin-3-ylmethyl]-piperidine-4-carboxylic acid

CAS: 727977-52-8

Purity: 98%

Color and Shape: Solid

Molecular weight: 353.3970031738281

Ref: 10-F020540