CAS 727977-57-3

1-[(8-Methyl-2-phenylimidazo[1,2-a]pyridin-3-yl)methyl]-4-piperidinecarboxylic acid

Description:

1-[(8-Methyl-2-phenylimidazo[1,2-a]pyridin-3-yl)methyl]-4-piperidinecarboxylic acid, with the CAS number 727977-57-3, is a chemical compound characterized by its complex structure, which includes an imidazo[1,2-a]pyridine moiety and a piperidinecarboxylic acid group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in medicinal chemistry. The presence of the piperidine ring suggests possible interactions with biological targets, potentially influencing pharmacological activity. The imidazo[1,2-a]pyridine component may contribute to its ability to engage in π-π stacking interactions, which can be significant in drug design. Additionally, the methyl and phenyl substituents can affect the lipophilicity and overall stability of the molecule. As with many compounds in this class, its specific characteristics, including melting point, boiling point, and reactivity, would need to be determined experimentally or sourced from detailed chemical databases for precise applications in research or industry.

Formula: C₂₁H₂₃N₃O₂

InChI: InChI=1S/C21H23N3O2/c1-15-6-5-11-24-18(14-23-12-9-17(10-13-23)21(25)26)19(22-20(15)24)16-7-3-2-4-8-16/h2-8,11,17H,9-10,12-14H2,1H3,(H,25,26)

InChI key: InChIKey=NCZHIHKNFIGYIR-UHFFFAOYSA-N

SMILES: C(C1=C(N=C2N1C=CC=C2C)C3=CC=CC=C3)N4CCC(C(O)=O)CC4

Synonyms:

• 1-[(8-Methyl-2-phenylimidazo[1,2-a]pyridin-3-yl)methyl]-4-piperidinecarboxylic acid
• 4-Piperidinecarboxylic acid, 1-[(8-methyl-2-phenylimidazo[1,2-a]pyridin-3-yl)methyl]-