CAS 727982-71-0

Acetamide, 2-chloro-N-(3,4-diethoxyphenyl)-

Description:

Acetamide, 2-chloro-N-(3,4-diethoxyphenyl)-, is an organic compound characterized by its amide functional group, which is derived from acetic acid. The presence of a chloro substituent at the 2-position and a diethoxyphenyl group at the nitrogen atom contributes to its unique chemical properties. This compound typically exhibits moderate solubility in organic solvents due to its hydrophobic diethoxyphenyl moiety, while the amide group can engage in hydrogen bonding, influencing its reactivity and interaction with other molecules. The chloro group may also participate in nucleophilic substitution reactions, making the compound potentially useful in various synthetic applications. Additionally, the presence of the diethoxyphenyl group may impart specific biological activities, which could be of interest in medicinal chemistry. Overall, the structural features of this compound suggest it may have applications in pharmaceuticals or as an intermediate in organic synthesis, although specific biological or chemical properties would require further investigation.

Formula: C₁₂H₁₆ClNO₃

InChI: InChI=1S/C12H16ClNO3/c1-3-16-10-6-5-9(14-12(15)8-13)7-11(10)17-4-2/h5-7H,3-4,8H2,1-2H3,(H,14,15)

InChI key: InChIKey=MRVUROCJAFSKEU-UHFFFAOYSA-N

SMILES: O(CC)C1=C(OCC)C=CC(NC(CCl)=O)=C1

Synonyms:

• 2-Chloro-N-(3,4-diethoxyphenyl)acetamide
• Acetamide, 2-chloro-N-(3,4-diethoxyphenyl)-