CAS 727983-32-6

1-[(2,3-Dichlorophenyl)sulfonyl]-4-piperidinecarboxylic acid

Description:

1-[(2,3-Dichlorophenyl)sulfonyl]-4-piperidinecarboxylic acid is a chemical compound characterized by its unique structure, which includes a piperidine ring and a sulfonyl group attached to a dichlorophenyl moiety. This compound typically exhibits properties associated with both acidic and basic functional groups, allowing it to participate in various chemical reactions. The presence of the sulfonyl group often enhances its solubility in polar solvents, while the piperidine ring contributes to its potential biological activity. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that can interact with biological targets. Additionally, the dichlorophenyl group may impart specific electronic properties, influencing the compound's reactivity and stability. As with many chemical substances, safety and handling precautions are essential, as it may pose risks depending on its toxicity profile and environmental impact. Overall, this compound represents a class of sulfonamide derivatives that can be explored for various applications in research and industry.

Formula: C₁₂H₁₃Cl₂NO₄S

InChI: InChI=1S/C12H13Cl2NO4S/c13-9-2-1-3-10(11(9)14)20(18,19)15-6-4-8(5-7-15)12(16)17/h1-3,8H,4-7H2,(H,16,17)

InChI key: InChIKey=SFTOWIQDHOZZCG-UHFFFAOYSA-N

SMILES: S(=O)(=O)(C1=C(Cl)C(Cl)=CC=C1)N2CCC(C(O)=O)CC2

Synonyms:

• 1-[(2,3-Dichlorophenyl)sulfonyl]-4-piperidinecarboxylic acid
• 4-Piperidinecarboxylic acid, 1-[(2,3-dichlorophenyl)sulfonyl]-

1-(2,3-Dichlorobenzenesulfonyl)piperidine-4-carboxylic acid

CAS: 727983-32-6

Versatile small molecule scaffold

Formula: C₁₂H₁₃Cl₂NO₄S

Purity: Min. 95%

Molecular weight: 338.2 g/mol

Ref: 3D-CEB98332