CymitQuimica logo

CAS 72799-58-7

:

α-(Aminomethyl)cyclopentanemethanol

Description:
α-(Aminomethyl)cyclopentanemethanol, with the CAS number 72799-58-7, is an organic compound characterized by its cyclopentane structure, which features an amino group and a hydroxymethyl group. This compound is typically a colorless to pale yellow liquid or solid, depending on its specific form and purity. It exhibits properties such as solubility in polar solvents due to the presence of the hydroxyl group, which can engage in hydrogen bonding. The amino group contributes to its basicity and potential reactivity in various chemical reactions, including nucleophilic substitutions and condensation reactions. Additionally, α-(Aminomethyl)cyclopentanemethanol may serve as an intermediate in the synthesis of pharmaceuticals or agrochemicals, owing to its functional groups that can participate in further chemical transformations. Its safety profile should be evaluated, as with any chemical substance, to ensure proper handling and usage in laboratory or industrial settings.
Formula:C7H15NO
InChI:InChI=1S/C7H15NO/c8-5-7(9)6-3-1-2-4-6/h6-7,9H,1-5,8H2
InChI key:InChIKey=CKKJQSVPBUAERO-UHFFFAOYSA-N
SMILES:C(CN)(O)C1CCCC1
Synonyms:
  • Cyclopentanemethanol, α-(aminomethyl)-
  • 2-Amino-1-cyclopentylethanol
  • α-(Aminomethyl)cyclopentanemethanol
  • 2-Amino-1-cyclopentylethan-1-ol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.