CymitQuimica logo

CAS 727994-89-0

:

(3-chlorophenyl)(2,3-dihydro-1,4-benzodioxin-6-yl)methanone

Description:
The chemical substance known as (3-chlorophenyl)(2,3-dihydro-1,4-benzodioxin-6-yl)methanone, with the CAS number 727994-89-0, is characterized by its complex molecular structure that includes a chlorophenyl group and a benzodioxin moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and stability. The presence of the chlorophenyl group suggests that it may have enhanced lipophilicity and could participate in various electrophilic substitution reactions. The benzodioxin structure may impart unique electronic properties and influence the compound's biological activity. Such compounds are often studied for their potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. Additionally, the presence of functional groups can affect solubility, melting point, and boiling point, which are critical for understanding its behavior in different environments. Overall, this compound's characteristics make it of interest in both synthetic and medicinal chemistry contexts.
Formula:C15H11ClO3
InChI:InChI=1/C15H11ClO3/c16-12-3-1-2-10(8-12)15(17)11-4-5-13-14(9-11)19-7-6-18-13/h1-5,8-9H,6-7H2
SMILES:c1cc(cc(c1)Cl)C(=O)c1ccc2c(c1)OCCO2
Synonyms:
  • Methanone, (3-Chlorophenyl)(2,3-Dihydro-1,4-Benzodioxin-6-Yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.