CAS 7280-81-1
:3-benzyl-3H-purin-6-amine
Description:
3-Benzyl-3H-purin-6-amine, with the CAS number 7280-81-1, is a purine derivative characterized by its structural features that include a benzyl group attached to the nitrogen atom at the 3-position of the purine ring. This compound exhibits properties typical of purines, such as being a heterocyclic aromatic organic compound. It is generally soluble in polar solvents, which is common for many purine derivatives, and may exhibit biological activity, potentially influencing various biochemical pathways. The presence of the benzyl group can enhance lipophilicity, affecting its interaction with biological membranes and receptors. Additionally, 3-benzyl-3H-purin-6-amine may serve as a scaffold for the development of pharmaceuticals, particularly in the field of nucleoside analogs or as potential inhibitors in enzymatic processes. Its reactivity and stability can be influenced by the functional groups present, making it a subject of interest in medicinal chemistry and drug design.
Formula:C12H11N5
InChI:InChI=1/C12H11N5/c13-11-10-12(15-7-14-10)17(8-16-11)6-9-4-2-1-3-5-9/h1-5,7-8H,6,13H2
SMILES:c1ccc(cc1)Cn1cnc(c2c1ncn2)N
Synonyms:- 3-Benzyladenine
- 3H-purin-6-amine, 3-(phenylmethyl)-
- Adenine, 3-benzyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3H-Purin-6-amine,3-(phenylmethyl)-
CAS:Formula:C12H11N5Purity:97%Color and Shape:SolidMolecular weight:225.24923-Benzyladenine
CAS:3-Benzyladenine is an alkylating agent that has been shown to inhibit the growth of certain bacteria. It has been used as a marker for epidemiological studies and in the production of monoclonal antibodies. 3-Benzyladenine binds to DNA by methylating the N7 position of guanine, which blocks DNA replication and transcription. 3-Benzyladenine also inhibits chloride transport in cells with a diet high in protein and prevents the growth of bacteria through hydrophobic interactions with cell membranes. The bactericidal activity of 3-benzyladenine can be increased by deuteration or base excision, which selectively destroys bacterial DNA.Formula:C12H11N5Purity:Min. 95%Color and Shape:PowderMolecular weight:225.25 g/mol3-Benzyladenine
CAS:Controlled ProductApplications 3-BENZYLADENINE (cas# 7280-81-1) is a useful research chemical.
Formula:C12H11N5Color and Shape:NeatMolecular weight:225.25




