CAS 7280-83-3

9H-Purine-2,6-diamine, sulfate (1:?)

Description:

9H-Purine-2,6-diamine, sulfate (1:?) is a chemical compound that belongs to the purine family, characterized by its bicyclic structure containing nitrogen atoms. This compound is often recognized for its role as a precursor in the synthesis of nucleotides and nucleic acids, which are essential for various biological processes, including DNA and RNA synthesis. The sulfate component indicates that it is present as a salt, which can influence its solubility and stability in aqueous solutions. Typically, purines exhibit properties such as being crystalline solids at room temperature, with moderate to high solubility in water, depending on the specific salt form. The compound is also known for its potential applications in biochemistry and pharmacology, particularly in the study of metabolic pathways and as a building block in the development of pharmaceuticals. Safety data sheets would provide specific handling and toxicity information, which is crucial for laboratory work involving this substance.

Formula: C₅H₆N₆·xH₂O₄S

InChI: InChI=1S/C5H6N6.H2O4S/c6-3-2-4(9-1-8-2)11-5(7)10-3;1-5(2,3)4/h1H,(H5,6,7,8,9,10,11);(H2,1,2,3,4)

InChI key: InChIKey=KYYLASPNTMEZTB-UHFFFAOYSA-N

SMILES: S(=O)(=O)(O)O.NC1=C2C(=NC(N)=N1)N=CN2

Synonyms:

• 9H-Purine-2,6-diamine, sulfate (1:?)
• 2,6-Diaminopurine sulfate
• Purine, 2,6-diamino-, sulfate
• 1H-Purine-2,6-diamine, sulfate