CAS 72800-72-7

Panaxydol

Description:

Panaxydol, with the CAS number 72800-72-7, is a chemical compound primarily derived from the roots of Panax ginseng, a plant known for its medicinal properties. It is classified as a triterpenoid saponin, which contributes to its bioactive characteristics. Panaxydol exhibits various pharmacological activities, including anti-inflammatory, antioxidant, and neuroprotective effects, making it of interest in both traditional medicine and modern pharmacology. The compound is often studied for its potential therapeutic applications, particularly in enhancing cognitive function and promoting overall health. Its structure features a complex arrangement of carbon, hydrogen, and oxygen atoms, typical of saponins, which allows it to interact with biological membranes and influence cellular processes. Additionally, Panaxydol's solubility and stability can vary depending on the formulation and conditions, impacting its bioavailability and efficacy in therapeutic contexts. Overall, Panaxydol represents a significant area of research in natural product chemistry and its potential health benefits.

Formula: C₁₇H₂₄O₂

InChI: InChI=1S/C17H24O2/c1-3-5-6-7-10-13-16-17(19-16)14-11-8-9-12-15(18)4-2/h4,15-18H,2-3,5-7,10,13-14H2,1H3/t15-,16+,17-/m1/s1

InChI key: InChIKey=GVLDSGIQZAFIAN-IXDOHACOSA-N

SMILES: C(C#CC#C[C@@H](C=C)O)[C@@H]1[C@H](CCCCCCC)O1

Synonyms:

• (3R)-8-[(2R,3S)-3-Heptyl-2-oxiranyl]-1-octene-4,6-diyn-3-ol
• Panaxydol
• 1-Octene-4,6-diyn-3-ol, 8-[(2R,3S)-3-heptyl-2-oxiranyl]-, (3R)-
• 1-Octene-4,6-diyn-3-ol, 8-[(2R,3S)-3-heptyloxiranyl]-, (3R)-
• 1-Octene-4,6-diyn-3-ol, 8-(3-heptyloxiranyl)-, [2R-[2α(R*),3α]]-

Panaxydol

CAS: 72800-72-7

Formula: C₁₇H₂₄O₂

Molecular weight: 260.38

Ref: 7W-GY1438

Panaxydol

CAS: 72800-72-7

Panaxydol has anti-cancer activity, can inhibit the growth and apoptosis of cancer cells, the signaling mechanisms involve a [Ca(2+)](i) increase, JNK and p38

Formula: C₁₇H₂₄O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 260.37

Ref: TM-TN2039

Panaxydol

CAS: 72800-72-7

Formula: C₁₇H₂₄O₂

Purity: 95%~99%

Color and Shape: Oil

Molecular weight: 260.377

Ref: BP-BP1657

Panaxydol

CAS: 72800-72-7

Formula: C₁₇H₂₄O₂

Molecular weight: 260.38

Ref: 4Z-P-175001

Panaxydol

CAS: 72800-72-7

Panaxydol is a bioactive compound, which is an acetylene derivative isolated from the roots of Panax ginseng. This compound is primarily sourced from the ginseng plant, known for its ethnobotanical uses and pharmacological activities. The mode of action of Panaxydol is believed to involve the modulation of cellular signaling pathways, including inhibition of cell proliferation and induction of apoptosis in cancer cells. This effect on cell cycle regulation and apoptosis suggests its potential as an anticancer agent. Additionally, Panaxydol exhibits anti-inflammatory properties by inhibiting the synthesis of pro-inflammatory cytokines and mediators, making it of interest in managing inflammatory conditions. The applications of Panaxydol are currently under extensive study in the context of cancer therapy, inflammation, and possibly other chronic diseases, reflecting its versatile biological activity and potential as a therapeutic compound. Research efforts continue to elucidate the full spectrum of its pharmacodynamics and therapeutic windows in preclinical and clinical settings.

Formula: C₁₇H₂₄O₂

Purity: Min. 95%

Molecular weight: 260.4 g/mol

Ref: 3D-XCA80072