CymitQuimica logo

CAS 72802-41-6

:

2-hydroxy-1-(3-nitrophenyl)ethanone

Description:
2-Hydroxy-1-(3-nitrophenyl)ethanone, also known as 3-nitrophenylacetone, is an organic compound characterized by its functional groups, including a hydroxyl group (-OH) and a ketone group (C=O) attached to an ethane backbone. The presence of the nitrophenyl group introduces significant polarity and potential reactivity, making it a useful intermediate in organic synthesis. This compound typically appears as a solid at room temperature and is soluble in polar organic solvents due to its functional groups. Its molecular structure allows for various chemical reactions, including nucleophilic substitutions and reductions. The nitro group can also participate in electrophilic aromatic substitution reactions, enhancing its utility in synthetic chemistry. Additionally, 2-hydroxy-1-(3-nitrophenyl)ethanone may exhibit biological activity, which can be explored for potential applications in pharmaceuticals or agrochemicals. Safety data should be consulted, as compounds with nitro groups can sometimes pose hazards, including toxicity or environmental concerns.
Formula:C8H7NO4
InChI:InChI=1/C8H7NO4/c10-5-8(11)6-2-1-3-7(4-6)9(12)13/h1-4,10H,5H2
SMILES:c1cc(cc(c1)N(=O)=O)C(=O)CO
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.