CAS 728024-36-0
:1-(4-morpholin-4-ylphenyl)ethanamine
Description:
1-(4-Morpholin-4-ylphenyl)ethanamine, identified by its CAS number 728024-36-0, is a chemical compound characterized by its amine functional group and a morpholine ring. This substance features a phenyl group substituted with a morpholine moiety, which contributes to its potential biological activity. The presence of the ethanamine structure indicates that it has two carbon atoms linked to the amine group, enhancing its solubility in polar solvents. The morpholine ring, a six-membered heterocycle containing both oxygen and nitrogen, imparts unique properties such as increased stability and the ability to engage in hydrogen bonding. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of therapeutic agents. Its structural characteristics suggest potential interactions with biological targets, which could be explored in drug discovery research. As with many amines, it may also participate in various chemical reactions, including alkylation and acylation, further expanding its utility in synthetic chemistry.
Formula:C12H18N2O
InChI:InChI=1/C12H18N2O/c1-10(13)11-2-4-12(5-3-11)14-6-8-15-9-7-14/h2-5,10H,6-9,13H2,1H3
SMILES:CC(c1ccc(cc1)N1CCOCC1)N
Synonyms:- Benzenemethanamine, Alpha-Methyl-4-(4-Morpholinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.