CAS 728024-39-3
:2-[(3,4-Dimethoxyphenyl)methyl]-2,3-dihydro-3-oxo-1H-isoindole-4-carboxylic acid
Description:
2-[(3,4-Dimethoxyphenyl)methyl]-2,3-dihydro-3-oxo-1H-isoindole-4-carboxylic acid, with the CAS number 728024-39-3, is a synthetic organic compound characterized by its complex structure, which includes an isoindole core. This compound features a carboxylic acid functional group, contributing to its acidic properties, and two methoxy groups on the phenyl ring, which can influence its solubility and reactivity. The presence of the dihydro-3-oxo moiety indicates that it may exhibit specific reactivity patterns typical of diketones or related compounds. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the isoindole framework, which is often associated with bioactive compounds. Additionally, the methoxy substituents may enhance its lipophilicity, potentially affecting its pharmacokinetic properties. Overall, this compound's unique structural features may contribute to its biological activity and utility in various chemical applications.
Formula:C18H17NO5
InChI:InChI=1S/C18H17NO5/c1-23-14-7-6-11(8-15(14)24-2)9-19-10-12-4-3-5-13(18(21)22)16(12)17(19)20/h3-8H,9-10H2,1-2H3,(H,21,22)
InChI key:InChIKey=RBCMSWHIMFOXRR-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C2C(CN(CC3=CC(OC)=C(OC)C=C3)C2=O)=CC=C1
Synonyms:- 2-(3,4-DIMETHOXYBENZYL)-3-OXOISOINDOLINE-4-CARBOXYLIC ACID
- 2-(3,4-Dimethoxybenzyl)-3-oxoisoindoline-4-carboxylic acid
- 2-[(3,4-Dimethoxyphenyl)methyl]-2,3-dihydro-3-oxo-1H-isoindole-4-carboxylic acid
- TOSLAB 868769
- CBI-BB ZERO/005342
- 2-(3,4-Dimethoxy-benzyl)-3-oxo-2,3-dihydro-1H-isoindole-4-carboxylic acid
- 2-(2,3-Dimethoxybenzyl)-3-oxoisoindoline-4-carboxylic acid
- 1H-Isoindole-4-carboxylic acid, 2-[(3,4-dimethoxyphenyl)methyl]-2,3-dihydro-3-oxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.