CAS 728024-41-7
:5-Fluoro-1-(phenylmethyl)-1H-indole-3-carboxaldehyde
Description:
5-Fluoro-1-(phenylmethyl)-1H-indole-3-carboxaldehyde is a synthetic organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a fluoro group at the 5-position and a phenylmethyl group at the 1-position contributes to its unique chemical properties and potential biological activity. The aldehyde functional group at the 3-position makes it reactive, allowing for various chemical transformations. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. Its molecular structure suggests potential interactions with biological targets, which could lead to applications in therapeutic contexts. Additionally, the compound's solubility, stability, and reactivity can be influenced by the presence of the fluorine atom and the aldehyde group, which may affect its behavior in different solvents and under various conditions. Overall, 5-Fluoro-1-(phenylmethyl)-1H-indole-3-carboxaldehyde represents a valuable compound for research in organic synthesis and medicinal chemistry.
Formula:C16H12FNO
InChI:InChI=1S/C16H12FNO/c17-14-6-7-16-15(8-14)13(11-19)10-18(16)9-12-4-2-1-3-5-12/h1-8,10-11H,9H2
InChI key:InChIKey=FEPHWPUFEZSGMM-UHFFFAOYSA-N
SMILES:C(=O)C=1C=2C(N(CC3=CC=CC=C3)C1)=CC=C(F)C2
Synonyms:- 1-Benzyl-5-fluoro-1H-indole-3-carbaldehyde
- 5-Fluoro-1-(phenylmethyl)-1H-indole-3-carboxaldehyde
- 1H-Indole-3-carboxaldehyde, 5-fluoro-1-(phenylmethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
