CymitQuimica logo

CAS 728024-43-9

:

1-(2-Aminophenyl)-2-(2-thienyl)ethanone

Description:
1-(2-Aminophenyl)-2-(2-thienyl)ethanone, with the CAS number 728024-43-9, is an organic compound characterized by its unique structural features, which include an ethanone moiety substituted with both an amino group and a thienyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds due to the presence of the phenyl and thienyl rings. It may display moderate solubility in organic solvents, and its reactivity can be influenced by the amino group, which can participate in various chemical reactions such as nucleophilic substitutions or coupling reactions. The thienyl group may also contribute to the compound's electronic properties, potentially affecting its behavior in biological systems or as a ligand in coordination chemistry. Additionally, compounds of this nature may have applications in pharmaceuticals or materials science, depending on their specific interactions and functionalization potential. As with any chemical substance, safety data sheets should be consulted for handling and toxicity information.
Formula:C12H11NOS
InChI:InChI=1S/C12H11NOS/c13-11-6-2-1-5-10(11)12(14)8-9-4-3-7-15-9/h1-7H,8,13H2
InChI key:InChIKey=VUKQCPUOORRJNJ-UHFFFAOYSA-N
SMILES:C(CC1=CC=CS1)(=O)C2=C(N)C=CC=C2
Synonyms:
  • Ethanone, 1-(2-aminophenyl)-2-(2-thienyl)-
  • 1-(2-Aminophenyl)-2-(2-thienyl)ethanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.