CAS 728024-47-3

1-(4-Fluorophenyl)-1H-1,2,3-triazole-4,5-dimethanol

Description:

1-(4-Fluorophenyl)-1H-1,2,3-triazole-4,5-dimethanol is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. The presence of the 4-fluorophenyl group indicates that a fluorine atom is substituted on a phenyl ring, enhancing the compound's potential for biological activity and influencing its electronic properties. The dimethanol functional groups at the 4 and 5 positions of the triazole ring suggest that the compound has hydroxyl (-OH) groups, which can participate in hydrogen bonding and may enhance solubility in polar solvents. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its unique structure allows for potential applications in various fields, including pharmaceuticals and agrochemicals. The CAS number 728024-47-3 serves as a unique identifier for this substance, facilitating its identification in chemical databases and literature. Overall, the combination of its functional groups and structural features contributes to its chemical reactivity and potential applications.

Formula: C₁₀H₁₀FN₃O₂

InChI: InChI=1S/C10H10FN3O2/c11-7-1-3-8(4-2-7)14-10(6-16)9(5-15)12-13-14/h1-4,15-16H,5-6H2

InChI key: InChIKey=BSCSIZOVBBYABS-UHFFFAOYSA-N

SMILES: C(O)C=1N(N=NC1CO)C2=CC=C(F)C=C2

Synonyms:

• 1H-1,2,3-Triazole-4,5-dimethanol, 1-(4-fluorophenyl)-
• 1-(4-Fluorophenyl)-1H-1,2,3-triazole-4,5-dimethanol