CymitQuimica logo

CAS 728024-48-4

:

1,3-Dihydro-4-methyl-5-(2-methylpropyl)-2H-imidazole-2-thione

Description:
1,3-Dihydro-4-methyl-5-(2-methylpropyl)-2H-imidazole-2-thione, with the CAS number 728024-48-4, is a heterocyclic compound featuring an imidazole ring. This compound is characterized by the presence of a thione functional group, which is a sulfur-containing moiety that can exhibit tautomerism with the corresponding thiol form. The structure includes a methyl group and a branched alkyl chain (2-methylpropyl) that contribute to its hydrophobic characteristics, potentially influencing its solubility and reactivity. The imidazole ring is known for its role in biological systems, often participating in enzyme catalysis and acting as a building block for various pharmaceuticals. The thione group may impart unique chemical properties, such as the ability to act as a ligand in coordination chemistry or as a precursor in organic synthesis. Overall, this compound's specific characteristics, including its molecular stability, reactivity, and potential applications, would be of interest in fields such as medicinal chemistry and materials science.
Formula:C8H14N2S
InChI:InChI=1S/C8H14N2S/c1-5(2)4-7-6(3)9-8(11)10-7/h5H,4H2,1-3H3,(H2,9,10,11)
InChI key:InChIKey=SWMKUDLMSPJJNA-UHFFFAOYSA-N
SMILES:C(C(C)C)C=1NC(=S)NC1C
Synonyms:
  • 2H-Imidazole-2-thione, 1,3-dihydro-4-methyl-5-(2-methylpropyl)-
  • 1,3-Dihydro-4-methyl-5-(2-methylpropyl)-2H-imidazole-2-thione
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.