CAS 728024-58-6

4-(1H-tetrazol-1-ylmethyl)benzoic acid

Description:

4-(1H-tetrazol-1-ylmethyl)benzoic acid is a chemical compound characterized by its unique structure, which includes a benzoic acid moiety and a tetrazole ring. The presence of the tetrazole group imparts notable properties, such as potential bioactivity and solubility in various solvents, making it of interest in pharmaceutical and material science applications. This compound typically exhibits acidic behavior due to the carboxylic acid functional group, allowing it to participate in various chemical reactions, including esterification and amidation. Its molecular structure suggests that it may engage in hydrogen bonding, influencing its solubility and interaction with biological targets. Additionally, the tetrazole ring can contribute to the compound's stability and reactivity, making it a versatile building block in organic synthesis. Overall, 4-(1H-tetrazol-1-ylmethyl)benzoic acid is a compound with significant potential for research and development in medicinal chemistry and related fields.

Formula: C₉H₈N₄O₂

InChI: InChI=1/C9H8N4O2/c14-9(15)8-3-1-7(2-4-8)5-13-6-10-11-12-13/h1-4,6H,5H2,(H,14,15)

SMILES: c1cc(ccc1Cn1cnnn1)C(=O)O

Synonyms:

• benzoic acid, 4-(1H-tetrazol-1-ylmethyl)-

4-[(1H-1,2,3,4-tetrazol-1-yl)methyl]benzoic acid

CAS: 728024-58-6

Formula: C₉H₈N₄O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 204.1854

Ref: IN-DA0061OF

4-Tetrazol-1-ylmethyl-benzoic acid

CAS: 728024-58-6

Formula: C₉H₈N₄O₂

Purity: 98%

Color and Shape: Solid, White powder

Molecular weight: 204.189

Ref: 10-F059506

4-(1H-Tetrazol-1-ylmethyl)benzoic Acid

Controlled Product

CAS: 728024-58-6

Formula: C₉H₈N₄O₂

Color and Shape: Neat

Molecular weight: 204.185

Ref: TR-B416138